Ethacridine lactate: Difference between revisions
Appearance
Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey. |
auto mw |
||
(29 intermediate revisions by 24 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Pair of enantiomers}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| IUPAC_name = 7-ethoxyacridine-3,9-diamine; 2-hydroxypropanoic acid |
|||
| Watchedfields = changed |
|||
| image = Ethacridinlactat.svg |
|||
| verifiedrevid = 477162867 |
|||
| alt = |
|||
| IUPAC_name = 7-Ethoxyacridine-3,9-diamine 2-hydroxypropanoic acid |
|||
| image = Ethacridinlactat.svg |
|||
| alt = Skeletal formulas of ethacridine lactate |
|||
| image2 = Ethacridine lactate 3D spacefill.png |
|||
| alt2 = Ball-and-stick models of the component ions of ethacridine lactate |
|||
<!--Clinical data--> |
|||
| tradename = |
|||
| Drugs.com = {{drugs.com|international|ethacridine-lactate}} |
|||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = <!-- A / B / C / D / X --> |
|||
| pregnancy_category = |
|||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|||
| legal_status = |
|||
| routes_of_administration = |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = |
|||
| protein_bound = |
|||
| metabolism = |
|||
| elimination_half-life = |
|||
| excretion = |
|||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|changed|??}} |
|||
| CAS_number = 1837-57-6 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 7T7T2I9823 |
|||
| ATCvet = |
|||
| ATC_prefix = B05 |
|||
| ATC_suffix = CA08 |
|||
| ATC_supplemental = {{ATC|D08|AA01}} |
|||
| PubChem = 15789 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 15012 |
| ChemSpiderID = 15012 |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| InChI = 1/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) |
|||
| KEGG = D01248 |
|||
| InChIKey = IYLLULUTZPKQBW-UHFFFAOYAM |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 582355 |
|||
<!--Chemical data--> |
|||
| C=18 | H=21 | N=3 | O=4 |
|||
| smiles = O=C(O)C(O)C.O(c2ccc1nc3c(c(c1c2)N)ccc(c3)N)CC |
| smiles = O=C(O)C(O)C.O(c2ccc1nc3c(c(c1c2)N)ccc(c3)N)CC |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) |
| StdInChI = 1S/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = IYLLULUTZPKQBW-UHFFFAOYSA-N |
| StdInChIKey = IYLLULUTZPKQBW-UHFFFAOYSA-N |
||
| CAS_number = 442-16-0 |
|||
| ATCvet = |
|||
| ATC_prefix = <!-- 'none' if uncategorised --> |
|||
| ATC_suffix = |
|||
| PubChem = 15789 |
|||
| DrugBank = |
|||
| C=18|H=21|N=3|O=4 |
|||
| molecular_weight = 343.37 |
|||
| bioavailability = |
|||
| protein_bound = |
|||
| metabolism = |
|||
| elimination_half-life = |
|||
| excretion = |
|||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = <!-- A / B / C / D / X --> |
|||
| pregnancy_category= |
|||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|||
| legal_status = |
|||
| routes_of_administration = |
|||
}} |
}} |
||
'''Ethacridine lactate''' (ethacridine monolactate monohydrate, '''acrinol''', trade name '''Rivanol''') is an [[aromatic]] [[organic compound]] based on [[acridine]]. Its formal name is 2-ethoxy-6,9-diaminoacridine monolactate monohydrate. It forms orange-yellow crystals with a melting point of 226 °C and it has a stinging smell. |
'''Ethacridine lactate''' (ethacridine monolactate monohydrate, '''acrinol''', [[trade name]] '''Rivanol''') is an [[aromatic]] [[organic compound]] based on [[acridine]]. Its formal name is 2-ethoxy-6,9-diaminoacridine monolactate monohydrate. It forms orange-yellow crystals with a melting point of 226 °C and it has a stinging smell. |
||
Its primary use is as an [[antiseptic]]<ref>Merck Index, 11th Ed., 3668</ref> in solutions of 0.1%. It is effective against mostly [[Gram-positive bacteria]], such as ''[[Streptococci]]'' and ''[[Staphylococci]]'', but ineffective against [[Gram-negative bacteria]] such as ''[[Pseudomonas aeruginosa]]''.<ref>{{cite journal |vauthors=Adarchenko AA, Krasil'nikov AP, Sobeshchuk OP |title=[Antiseptic sensitivity of clinical strains of Pseudomonas aeruginosa] |language=Russian |journal=Antibiotiki I Khimioterapiia |volume=34 |issue=12 |pages=902–7 |year=1989 |pmid=2517004 }}</ref> |
|||
Its primary use is as an [[antiseptic]] in solutions of 0.1%. |
|||
Ethacridine is also used as an agent for second trimester abortion. Up to 150 ml of a 0.1% solution is instilled extra-amniotically using a [[foley catheter]]. After 20 to 40 hours, 'mini labor' ensues. In China, an intra-amniotic method has also been used. |
Ethacridine is also used as an agent for second trimester abortion. Up to 150 ml of a 0.1% solution is instilled extra-amniotically using a [[foley catheter]]. After 20 to 40 hours, 'mini labor' ensues. In China, an intra-amniotic method has also been used.<ref>{{Cite journal |
||
| last1 = Tien | first1 = K. H. |
|||
| title = Intraamniotic injection of ethacridine for second-trimester induction of labor |
|||
| journal = Obstetrics and Gynecology |
|||
| volume = 61 |
|||
| issue = 6 |
|||
| pages = 733–736 |
|||
| year = 1983 |
|||
| pmid = 6843933 |
|||
}}</ref> Ethacridine as an abortifacient is found to be safer and better tolerated than 20% hypertonic saline. |
|||
== References == |
== References == |
||
{{reflist}} |
|||
* ''Obstetrics & Gynecology'' 1983;61:733-736 |
|||
* Merck Index, 11th Ed., 3668. |
|||
{{Blood substitutes and perfusion solutions}} |
|||
{{Antiseptics and disinfectants}} |
{{Antiseptics and disinfectants}} |
||
[[Category:Antiseptics]] |
[[Category:Antiseptics]] |
||
[[Category:Aromatic compounds]] |
|||
[[Category:Lactates]] |
[[Category:Lactates]] |
||
[[Category:Acridines]] |
[[Category:Acridines]] |
||
[[Category:Phenol ethers]] |
[[Category:Phenol ethers]] |
||
[[Category:Aromatic amines]] |
[[Category:Aromatic amines]] |
||
[[Category:Ethoxy compounds]] |
|||
[[de:Ethacridinlactat]] |
|||
[[fa:اتاکریدین لاکتات]] |
|||
[[ja:アクリノール]] |
|||
[[pl:Rywanol]] |
|||
[[ro:Rivanol]] |
|||
[[zh:雷佛奴爾]] |