Jump to content

Ethacridine lactate: Difference between revisions

Page 1
Page 2
Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.
auto mw
 
(29 intermediate revisions by 24 users not shown)
Line 1: Line 1:
{{Short description|Pair of enantiomers}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| IUPAC_name = 7-ethoxyacridine-3,9-diamine; 2-hydroxypropanoic acid
| Watchedfields = changed
| image = Ethacridinlactat.svg
| verifiedrevid = 477162867
| alt =
| IUPAC_name = 7-Ethoxyacridine-3,9-diamine 2-hydroxypropanoic acid
| image = Ethacridinlactat.svg
| alt = Skeletal formulas of ethacridine lactate
| image2 = Ethacridine lactate 3D spacefill.png
| alt2 = Ball-and-stick models of the component ions of ethacridine lactate

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|ethacridine-lactate}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 1837-57-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7T7T2I9823
| ATCvet =
| ATC_prefix = B05
| ATC_suffix = CA08
| ATC_supplemental = {{ATC|D08|AA01}}
| PubChem = 15789
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 15012
| ChemSpiderID = 15012
| KEGG_Ref = {{keggcite|correct|kegg}}
| InChI = 1/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6)
| KEGG = D01248
| InChIKey = IYLLULUTZPKQBW-UHFFFAOYAM
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 582355

<!--Chemical data-->
| C=18 | H=21 | N=3 | O=4
| smiles = O=C(O)C(O)C.O(c2ccc1nc3c(c(c1c2)N)ccc(c3)N)CC
| smiles = O=C(O)C(O)C.O(c2ccc1nc3c(c(c1c2)N)ccc(c3)N)CC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6)
| StdInChI = 1S/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IYLLULUTZPKQBW-UHFFFAOYSA-N
| StdInChIKey = IYLLULUTZPKQBW-UHFFFAOYSA-N
| CAS_number = 442-16-0
| ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised -->
| ATC_suffix =
| PubChem = 15789
| DrugBank =
| C=18|H=21|N=3|O=4
| molecular_weight = 343.37
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}
}}


'''Ethacridine lactate''' (ethacridine monolactate monohydrate, '''acrinol''', trade name '''Rivanol''') is an [[aromatic]] [[organic compound]] based on [[acridine]]. Its formal name is 2-ethoxy-6,9-diaminoacridine monolactate monohydrate. It forms orange-yellow crystals with a melting point of 226 °C and it has a stinging smell.
'''Ethacridine lactate''' (ethacridine monolactate monohydrate, '''acrinol''', [[trade name]] '''Rivanol''') is an [[aromatic]] [[organic compound]] based on [[acridine]]. Its formal name is 2-ethoxy-6,9-diaminoacridine monolactate monohydrate. It forms orange-yellow crystals with a melting point of 226 °C and it has a stinging smell.


Its primary use is as an [[antiseptic]]<ref>Merck Index, 11th Ed., 3668</ref> in solutions of 0.1%. It is effective against mostly [[Gram-positive bacteria]], such as ''[[Streptococci]]'' and ''[[Staphylococci]]'', but ineffective against [[Gram-negative bacteria]] such as ''[[Pseudomonas aeruginosa]]''.<ref>{{cite journal |vauthors=Adarchenko AA, Krasil'nikov AP, Sobeshchuk OP |title=[Antiseptic sensitivity of clinical strains of Pseudomonas aeruginosa] |language=Russian |journal=Antibiotiki I Khimioterapiia |volume=34 |issue=12 |pages=902–7 |year=1989 |pmid=2517004 }}</ref>
Its primary use is as an [[antiseptic]] in solutions of 0.1%.


Ethacridine is also used as an agent for second trimester abortion. Up to 150 ml of a 0.1% solution is instilled extra-amniotically using a [[foley catheter]]. After 20 to 40 hours, 'mini labor' ensues. In China, an intra-amniotic method has also been used. Ethacridine as an abortifacient is found to be safer and better tolerated than 20% hypertonic saline.
Ethacridine is also used as an agent for second trimester abortion. Up to 150 ml of a 0.1% solution is instilled extra-amniotically using a [[foley catheter]]. After 20 to 40 hours, 'mini labor' ensues. In China, an intra-amniotic method has also been used.<ref>{{Cite journal
| last1 = Tien | first1 = K. H.
| title = Intraamniotic injection of ethacridine for second-trimester induction of labor
| journal = Obstetrics and Gynecology
| volume = 61
| issue = 6
| pages = 733–736
| year = 1983
| pmid = 6843933
}}</ref> Ethacridine as an abortifacient is found to be safer and better tolerated than 20% hypertonic saline.


== References ==
== References ==
{{reflist}}
* ''Obstetrics & Gynecology'' 1983;61:733-736
* Merck Index, 11th Ed., 3668.


{{Blood substitutes and perfusion solutions}}
{{Antiseptics and disinfectants}}
{{Antiseptics and disinfectants}}


[[Category:Antiseptics]]
[[Category:Antiseptics]]
[[Category:Aromatic compounds]]
[[Category:Lactates]]
[[Category:Lactates]]
[[Category:Acridines]]
[[Category:Acridines]]
[[Category:Phenol ethers]]
[[Category:Phenol ethers]]
[[Category:Aromatic amines]]
[[Category:Aromatic amines]]
[[Category:Ethoxy compounds]]

[[de:Ethacridinlactat]]
[[fa:اتاکریدین لاکتات]]
[[ja:アクリノール]]
[[pl:Rywanol]]
[[ro:Rivanol]]
[[zh:雷佛奴爾]]