Izvorni kod stranice Azelastin

{{Drugbox-lat
| IUPAC_name        = 
| image             = Azelastine.svg
| width             = 
| alt               = 
| image2            = 
| width2            = 
| alt2              = 
| imagename         = 
| drug_name         = Azelastin
| caption           =

<!-- Clinical data -->
| tradename         = Astelin, Optivar, Allergodil
| Drugs.com         = {{drugs.com-lat|monograph|Azelastine}}
| MedlinePlus       = 
| licence_EU        = 
| licence_US        = 
| DailyMedID        = 
| pregnancy_AU      = 
| pregnancy_US      = 
| pregnancy_category= 
| legal_AU          = 
| legal_CA          = 
| legal_UK          = 
| legal_US          = 
| legal_status      = 
| dependency_liability = 
| routes_of_administration = Oftalmički, nazalno

<!-- Pharmacokinetic data -->
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| elimination_half-life = 22 h
| excretion         = Fekalno

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|}}
| CAS_number        = 58581-89-8
| CAS_supplemental  = 
| ATCvet            = 
| ATC_prefix        = R01
| ATC_suffix        = AC03
| ATC_supplemental  = , {{ATC|S01|GX07}}
| PubChem           = 2267
| PubChemSubstance  = 46507582
| IUPHAR_ligand     = 
| DrugBank_Ref      = {{drugbankcite|correct|drugbank}}
| DrugBank          = DB00972
| ChemSpiderID_Ref  = {{chemspidercite|correct|chemspider}}
| ChemSpiderID      = 2180
| UNII_Ref          = {{fdacite|correct|FDA}}
| UNII              = 
| KEGG_Ref          = {{keggcite|correct|kegg}}
| KEGG              = C07768
| ChEBI_Ref         = {{ebicite|correct|EBI}}
| ChEBI             = 2950
| ChEMBL_Ref        = {{ebicite|correct|EBI}}
| ChEMBL            = 639
| synonyms          =

<!-- Chemical data -->
|C=22 |H=24 |Cl=1 |N=3 |O=1
| molecular_weight  = 381,898
| smiles            = CN1CCCC(CC1)N1N=C(CC2=CC=C(Cl)C=C2)C2=CC=CC=C2C1=O
| StdInChI          = 1S/C22H24ClN3O/c1-25-13-4-5-18(12-14-25)26-22(27)20-7-3-2-6-19(20)21(24-26)15-16-8-10-17(23)11-9-16/h2-3,6-11,18H,4-5,12-15H2,1H3
| StdInChIKey_Ref   = {{stdinchicite|correct|chemspider}}
| StdInChI_comment  = 
| StdInChIKey       = MBUVEWMHONZEQD-UHFFFAOYSA-N
| StdStdInChI_Ref   = {{stdinchicite|correct|chemspider}}
| density           = 
| melting_point     = 225
| melting_high      = 
| melting_notes     = 
| boiling_point     = 
| boiling_notes     = 
| solubility        = 
| specific_rotation = 
| sec_combustion    = 
}}
'''Azelastin''' je [[organsko jedinjenje]], koje sadrži 22 [[atom]]a [[ugljenik]]a i ima [[Molekulska masa|molekulsku masu]] od 381,898 [[Jedinica atomske mase|Da]].<ref>Horak F: Effectiveness of twice daily azelastine nasal spray in patients with seasonal allergic rhinitis. Ther Clin Risk Manag. 2008 Oct;4(5):1009-22. [[PubMed|PMID]] [http://www.ncbi.nlm.nih.gov/pubmed/19209282 19209282]</ref><ref>Bernstein JA: Azelastine hydrochloride: a review of pharmacology, pharmacokinetics, clinical efficacy and tolerability. Curr Med Res Opin. 2007 Oct;23(10):2441-52. [[PubMed|PMID]] [http://www.ncbi.nlm.nih.gov/pubmed/17723160 17723160]</ref><ref>{{Cite pmid|21059682|noedit}}</ref><ref>{{cite pmid|18048412|noedit}}</ref>

== Osobine ==

{| class="wikitable sortable"
|-
! Osobina !! Vrednost
|-
| [[Vodonična veza|Broj akceptora vodonika]] || 3
|-
| [[Vodonična veza|Broj donora vodonika]] || 0
|-
| [[Geometrija molekula|Broj rotacionih veza]] || 3
|-
| [[Particioni koeficijent]]<ref>{{cite doi/10.1021/jp980230o|noedit}}</ref> (''ALogP'') || 4,1
|-
| [[Rastvorljivost]]<ref>{{cite pmid|11749573|noedit}}</ref> (''logS'', log(''mol/L'')) || -5,7
|-
| [[Polarna površina molekula|Polarna površina]]<ref>{{cite pmid|11020286|noedit}}</ref> (''PSA'', [[Angstrem (jedinica)|Å<sup>2</sup>]]) || 35,9 
|}

== Reference ==
{{reflist|2}}

== Literatura ==
{{refbegin}}
* {{GoodmanGilman10th}}
* {{FoyePrinciplesMedChem6th}}
{{refend}}
== Spoljašnje veze ==
{{Portal-lat|Medicina|Hemija}}
{{Commonscat-lat|Azelastine}}
* [http://www.drugbank.ca/drugs/DB00972 Azelastine]

{{Histaminergici}}

[[Kategorija:Inhibitori oksidoreduktaze]]
[[Kategorija:Antiagregacijski lekovi]]
[[Kategorija:Bronhodilatatori]]
[[Kategorija:Antagonisti H1 receptora]]
[[Kategorija:Acetamidi]]
[[Kategorija:Amini]]
[[Kategorija:Organohloridi]]
[[Kategorija:Azepani]]