Viscumamide: Difference between revisions
Appearance
Content deleted Content added
chembox data; minor cleanup |
added Category:Pentapeptides using HotCat |
||
(8 intermediate revisions by 8 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Chembox |
{{Chembox |
||
| |
| ImageFile = Viscumamide Structure.svg |
||
| |
| ImageSize = |
||
| IUPACName = Cyclo(isoleucylleucylisoleucylleucylleucyl) |
| IUPACName = Cyclo(isoleucylleucylisoleucylleucylleucyl) |
||
| OtherNames = Cyclic(<small>L</small>-isoleucyl-<small>L</small>-leucyl-<small>L</small>-isoleucyl-<small>L</small>-leucyl-<small>L</small>-leucyl) |
|||
| OtherNames = |
|||
| |
|Section1={{Chembox Identifiers |
||
| |
| CASNo = 38184-76-8 |
||
| |
| PubChem = 559969 |
||
| |
| ChemSpiderID = 486785 |
||
| |
| SMILES = [C@@H](CC)(C)[C@]1(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@]([C@H](CC)C)(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N1)[H])[H] |
||
| |
| StdInChI=1S/C30H55N5O5/c1-11-19(9)24-29(39)32-21(13-16(3)4)26(36)31-22(14-17(5)6)27(37)34-25(20(10)12-2)30(40)33-23(15-18(7)8)28(38)35-24/h16-25H,11-15H2,1-10H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38) |
||
| |
| StdInChIKey = KACXIDDXMHJUSH-UHFFFAOYSA-N |
||
| StdInChI = 1S/C30H55N5O5/c1-11-19(9)24-29(39)32-21(13-16(3)4)26(36)31-22(14-17(5)6)27(37)34-25(20(10)12-2)30(40)33-23(15-18(7)8)28(38)35-24/h16-25H,11-15H2,1-10H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38) |
|||
| StdInChIKey = KACXIDDXMHJUSH-UHFFFAOYSA-N |
|||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| |
| C=30 | H=55 | N=5 | O=5 |
||
| |
| Appearance = |
||
| |
| Density = |
||
| |
| MeltingPt = |
||
| |
| BoilingPt = |
||
| |
| Solubility = |
||
}} |
}} |
||
| |
|Section3={{Chembox Hazards |
||
| |
| MainHazards = |
||
| |
| FlashPt = |
||
| |
| AutoignitionPt = |
||
}} |
}} |
||
}} |
}} |
||
'''Viscumamide''' is a [[cyclic peptide]] isolated from endophytic fungi of [[mangrove]].<ref>{{cite journal | pmid = 18422185}}</ref> |
'''Viscumamide''' is a [[cyclic peptide]] isolated from endophytic fungi of [[mangrove]].<ref>{{cite journal | pmid = 18422185 | year = 2007 | last1 = Guo | first1 = ZY | last2 = Huang | first2 = ZJ | last3 = Wen | first3 = L | last4 = Wan | first4 = Q | last5 = Liu | first5 = F | last6 = She | first6 = ZG | last7 = Lin | first7 = YC | last8 = Zhou | first8 = SN | title = The metabolites of cyclic peptides from three endophytic mangrove fungi | volume = 30 | issue = 12 | pages = 1526–9 | journal = Zhong Yao Cai}}</ref> |
||
==References== |
==References== |
||
{{reflist}} |
{{reflist}} |
||
[[Category:Cyclic peptides]] |
|||
[[Category:Pentapeptides]] |
|||
Latest revision as of 11:25, 1 June 2023
Names | |
---|---|
IUPAC name
Cyclo(isoleucylleucylisoleucylleucylleucyl)
| |
Other names
Cyclic(L-isoleucyl-L-leucyl-L-isoleucyl-L-leucyl-L-leucyl)
| |
Identifiers | |
3D model (JSmol)
|
|
ChemSpider | |
PubChem CID
|
|
| |
| |
Properties | |
C30H55N5O5 | |
Molar mass | 565.800 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Viscumamide is a cyclic peptide isolated from endophytic fungi of mangrove.[1]
References
[edit]