Viscumamide: Difference between revisions

Viscumamide
Names
	IUPAC name Cyclo(isoleucylleucylisoleucylleucylleucyl)
	Other names Cyclic(L-isoleucyl-L-leucyl-L-isoleucyl-L-leucyl-L-leucyl)
Identifiers
CAS Number	38184-76-8;
3D model (JSmol)	Interactive image;
ChemSpider	486785;
PubChem CID	559969;
	InChI InChI=1S/C30H55N5O5/c1-11-19(9)24-29(39)32-21(13-16(3)4)26(36)31-22(14-17(5)6)27(37)34-25(20(10)12-2)30(40)33-23(15-18(7)8)28(38)35-24/h16-25H,11-15H2,1-10H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38) Key: KACXIDDXMHJUSH-UHFFFAOYSA-N;
	SMILES [C@@H](CC)(C)[C@]1(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@]([C@H](CC)C)(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N1)[H])[H];
Properties
Chemical formula	C30H55N5O5
Molar mass	565.800 g·mol−1
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

Inline

Latest revision as of 11:25, 1 June 2023

Viscumamide is a cyclic peptide isolated from endophytic fungi of mangrove.^[1]

References

^ Guo, ZY; Huang, ZJ; Wen, L; Wan, Q; Liu, F; She, ZG; Lin, YC; Zhou, SN (2007). "The metabolites of cyclic peptides from three endophytic mangrove fungi". Zhong Yao Cai. 30 (12): 1526–9. PMID 18422185.

This article about an organic compound is a stub. You can help Wikipedia by expanding it.

[1] Guo, ZY; Huang, ZJ; Wen, L; Wan, Q; Liu, F; She, ZG; Lin, YC; Zhou, SN (2007). "The metabolites of cyclic peptides from three endophytic mangrove fungi". Zhong Yao Cai. 30 (12): 1526–9. PMID 18422185.

[1]

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
 {{Chembox
-|  ImageFile = Viscumamide.png
+| ImageFile = Viscumamide Structure.svg
-|   ImageSize = 228px
+| ImageSize =
 | IUPACName = Cyclo(isoleucylleucylisoleucylleucylleucyl)
+| OtherNames = Cyclic(<small>L</small>-isoleucyl-<small>L</small>-leucyl-<small>L</small>-isoleucyl-<small>L</small>-leucyl-<small>L</small>-leucyl)
-| OtherNames =
-| Section1 = {{Chembox Identifiers
+|Section1={{Chembox Identifiers
-|  CASNo =
+| CASNo = 38184-76-8
-|  PubChem = 559969
+| PubChem = 559969
-|  ChemSpiderID = 486785
+| ChemSpiderID = 486785
-|  SMILES = O=C1NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1C(C)CC)CC(C)C)C(C)CC)CC(C)C)CC(C)C
+| SMILES = [C@@H](CC)(C)[C@]1(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@]([C@H](CC)C)(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N1)[H])[H]
-|  InChI = 1/C30H55N5O5/c1-11-19(9)24-29(39)32-21(13-16(3)4)26(36)31-22(14-17(5)6)27(37)34-25(20(10)12-2)30(40)33-23(15-18(7)8)28(38)35-24/h16-25H,11-15H2,1-10H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38)
+| StdInChI=1S/C30H55N5O5/c1-11-19(9)24-29(39)32-21(13-16(3)4)26(36)31-22(14-17(5)6)27(37)34-25(20(10)12-2)30(40)33-23(15-18(7)8)28(38)35-24/h16-25H,11-15H2,1-10H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38)
-|  InChIKey = KACXIDDXMHJUSH-UHFFFAOYAM
+| StdInChIKey = KACXIDDXMHJUSH-UHFFFAOYSA-N
-|  StdInChI = 1S/C30H55N5O5/c1-11-19(9)24-29(39)32-21(13-16(3)4)26(36)31-22(14-17(5)6)27(37)34-25(20(10)12-2)30(40)33-23(15-18(7)8)28(38)35-24/h16-25H,11-15H2,1-10H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,35,38)
-|  StdInChIKey = KACXIDDXMHJUSH-UHFFFAOYSA-N
   }}
-| Section2 = {{Chembox Properties
+|Section2={{Chembox Properties
-|  C=30|H=55|N=5|O=5
+| C=30 | H=55 | N=5 | O=5
-|  Appearance =
+| Appearance =
-|  Density =
+| Density =
-|  MeltingPt =
+| MeltingPt =
-|  BoilingPt =
+| BoilingPt =
-|  Solubility =
+| Solubility =
   }}
-| Section3 = {{Chembox Hazards
+|Section3={{Chembox Hazards
-|  MainHazards =
+| MainHazards =
-|  FlashPt =
+| FlashPt =
-|  Autoignition =
+| AutoignitionPt =
   }}
 }}
-'''Viscumamide''' is a [[cyclic peptide]] isolated from endophytic fungi of [[mangrove]].<ref>{{cite journal | pmid = 18422185 | year = 2007 | last1 = Guo | first1 = ZY | last2 = Huang | first2 = ZJ | last3 = Wen | first3 = L | last4 = Wan | first4 = Q | last5 = Liu | first5 = F | last6 = She | first6 = ZG | last7 = Lin | first7 = YC | last8 = Zhou | first8 = SN | title = The metabolites of cyclic peptides from three endophytic mangrove fungi | volume = 30 | issue = 12 | pages = 1526–9 | journal = Zhong yao cai = Zhongyaocai = Journal of Chinese medicinal materials}}</ref>
+'''Viscumamide''' is a [[cyclic peptide]] isolated from endophytic fungi of [[mangrove]].<ref>{{cite journal | pmid = 18422185 | year = 2007 | last1 = Guo | first1 = ZY | last2 = Huang | first2 = ZJ | last3 = Wen | first3 = L | last4 = Wan | first4 = Q | last5 = Liu | first5 = F | last6 = She | first6 = ZG | last7 = Lin | first7 = YC | last8 = Zhou | first8 = SN | title = The metabolites of cyclic peptides from three endophytic mangrove fungi | volume = 30 | issue = 12 | pages = 1526–9 | journal = Zhong Yao Cai}}</ref>
 ==References==
 {{reflist}}
+[[Category:Cyclic peptides]]
+[[Category:Pentapeptides]]
-{{organic-compound-stub}}
+{{organic-compound-stub}}
-[[Category:Cyclic peptides]]