JWH-161: Difference between revisions

JWH-161
Identifiers
	IUPAC name (4aR,13bR)-2,5,5-trimethyl-8-pentyl-3,4,4a,5,8,13b-hexahydroisochromeno[3,4-b]carbazol-13-ol;
PubChem CID	10431286;
CompTox Dashboard (EPA)	DTXSID201029576 ;
Chemical and physical data
Formula	C27H33NO2
Molar mass	403.555 g/mol g·mol−1
3D model (JSmol)	Interactive image;
	SMILES c5cccc1c5c2c(O)c(c(OC3(C)C)cc2n1CCCCC)C4C3CCC(C)=C4;
	(verify)

Browse history interactively

← Previous edit Next edit →

Content deleted Content added

VisualWikitext

Inline

Revision as of 20:29, 20 September 2011

JWH-161 is a cannabinoid derivative that was designed by Dr John W. Huffman's team as a hybrid between the dibenzopyran "classical" cannabinoid drugs and the novel indole derivatives, in an attempt to unravel the differences in their binding modes to the CB₁ receptor. While retaining structural elements from both families, JWH-161 has a CB₁ K_i of 19.0nM, although it was found to be slightly weaker than THC in animal tests.^[1]

References

^ Huffman JW, Padgett LW (2005). "Recent developments in the medicinal chemistry of cannabimimetic indoles, pyrroles and indenes". Current Medicinal Chemistry. 12 (12): 1395–411. doi:10.2174/0929867054020864. PMID 15974991.

This cannabinoid related article is a stub. You can help Wikipedia by expanding it.

[pmid15974991-1] Huffman JW, Padgett LW (2005). "Recent developments in the medicinal chemistry of cannabimimetic indoles, pyrroles and indenes". Current Medicinal Chemistry. 12 (12): 1395–411. doi:10.2174/0929867054020864. PMID 15974991.

[1]

@@ Line 1: / Line 1: @@
-{{Drugbox| verifiedrevid = 410898358
+{{Drugbox
+| verifiedrevid = 410898358
+| IUPAC_name = (4aR,13bR)-2,5,5-trimethyl-8-pentyl-3,4,4a,5,8,13b-hexahydroisochromeno[3,4-b]carbazol-13-ol
-|
-|IUPAC_name = (4aR,13bR)-2,5,5-trimethyl-8-pentyl-3,4,4a,5,8,13b-hexahydroisochromeno[3,4-b]carbazol-13-ol
 | image = JWH-161_structure.png
-| width= 240
+| width = 240
-| CAS_number=
+<!--Clinical data-->
-| ATC_prefix=
+| tradename =
-| ATC_suffix=
+| legal_status =
-| PubChem= 10431286
+| routes_of_administration =
-| DrugBank=
-| C=27 | H=33 | N=1 | O=2
+<!--Pharmacokinetic data-->
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number =
+| PubChem = 10431286
+<!--Chemical data-->
+| C=27 | H=33 | N=1 | O=2
 | molecular_weight = 403.555 g/mol
 | smiles = c5cccc1c5c2c(O)c(c(OC3(C)C)cc2n1CCCCC)C4C3CCC(C)=C4
-| bioavailability=
-| metabolism =
-| elimination_half-life=
-| excretion =
-| pregnancy_category =
-| legal_status =
-| routes_of_administration=
 }}