| Predicate |
Object |
| assignee |
http://rdf.ncbi.nlm.nih.gov/pubchem/patentassignee/MD5_1543b2b19ec0e331a0dcd89888cbef5f |
| classificationCPCAdditional |
http://rdf.ncbi.nlm.nih.gov/pubchem/patentcpc/C09J2203-354
http://rdf.ncbi.nlm.nih.gov/pubchem/patentcpc/C09J2203-35
http://rdf.ncbi.nlm.nih.gov/pubchem/patentcpc/C09J2203-326
http://rdf.ncbi.nlm.nih.gov/pubchem/patentcpc/C09J2433-00 |
| classificationCPCInventive |
http://rdf.ncbi.nlm.nih.gov/pubchem/patentcpc/C09J5-00 |
| classificationIPCInventive |
http://rdf.ncbi.nlm.nih.gov/pubchem/patentipc/C09J5-00 |
| filingDate |
2021-12-17^^<http://www.w3.org/2001/XMLSchema#date> |
| inventor |
http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_93522aa5e8d7fc592cd70031b8725e2f
http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_c7febb0986320532f3190823d569471e
http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_75f636d80a12f595865f275228fa7172
http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_9bc877cbb2bc188dfeaece20a034269a
http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_c2e01ed4a4f6c16be59fc3c213f97c53
http://rdf.ncbi.nlm.nih.gov/pubchem/patentinventor/MD5_2d60c27ade0fc137d1142e7dc111822d |
| publicationDate |
2022-06-23^^<http://www.w3.org/2001/XMLSchema#date> |
| publicationNumber |
WO-2022130340-A1 |
| titleOfInvention |
Composition including monomer with a carboxylic acid group, monomer with a hydroxyl group, a cycloalkyl monomer, and crosslinker and related articles and methods |
| abstract |
The composition includes at least 16 percent by weight of an acrylic monomer comprising a cycloalkyl group having up to 12 carbon atoms, an acrylic monomer having a carboxylic acid group, an acrylic monomer having a hydroxyl group, and a compound composed of divalent segments L and at least two X groups. The divalent segments L are represented by formula L. Each segment L is respectively directly bonded to two secondary N atoms, two tertiary N atoms, or a secondary and a tertiary N atom. Each R1 represents an alkylene group having from 1 to 4 carbon atoms, and at least some of the R1 groups are -CH2-CH2-CH2-CH2-. Each X group is independently represented by the formula CH2=C(R)-C(O)-O-V-W-C(O)-. Articles and methods using the composition are also described. |
| isCitedBy |
http://rdf.ncbi.nlm.nih.gov/pubchem/patent/US-2022195093-A1
http://rdf.ncbi.nlm.nih.gov/pubchem/patent/US-11739172-B2 |
| priorityDate |
2020-12-17^^<http://www.w3.org/2001/XMLSchema#date> |
| type |
http://data.epo.org/linked-data/def/patent/Publication |